
CAS 98072-05-0
:2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate
Description:
2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate, identified by CAS number 98072-05-0, is a chemical compound characterized by its complex structure that includes a long-chain polyether backbone and a phosphate group. This compound features multiple ether linkages, which contribute to its solubility in various solvents and its potential use in surfactant applications. The presence of the phenyl group suggests that it may exhibit aromatic properties, potentially influencing its reactivity and interactions with other molecules. The hydrogen phosphate moiety indicates that it can participate in acid-base reactions, making it relevant in biochemical contexts. Additionally, the long carbon chain may impart hydrophobic characteristics, while the polar functional groups enhance its hydrophilicity. Overall, this compound's unique combination of hydrophilic and hydrophobic properties makes it suitable for applications in fields such as pharmaceuticals, materials science, and biochemistry, particularly in the formulation of drug delivery systems or as a surfactant in various industrial processes.
Formula:C34H55O14P
InChI:InChI=1S/C34H55O14P/c35-49(36,47-29-27-43-21-19-39-13-11-37-15-17-41-23-25-45-31-33-7-3-1-4-8-33)48-30-28-44-22-20-40-14-12-38-16-18-42-24-26-46-32-34-9-5-2-6-10-34/h1-10H,11-32H2,(H,35,36)
InChI key:InChIKey=CXZCZDXBXGKRQH-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOP(OCCOCCOCCOCCOCCOCC1=CC=CC=C1)(=O)O)C2=CC=CC=C2
Synonyms:- 2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate
CAS:Formula:C34H55O14PMolecular weight:718.7659
