CAS 98102-34-2
:2-(β-D-Glucopyranosyloxy)-5-hydroxybenzoic acid
Description:
2-(β-D-Glucopyranosyloxy)-5-hydroxybenzoic acid, also known as salicylic acid glucoside, is a glycosylated derivative of salicylic acid. This compound features a β-D-glucopyranosyl moiety linked to the hydroxyl group of the salicylic acid structure, which contributes to its solubility and biological activity. It typically appears as a white to off-white solid and is soluble in water due to the presence of the glucopyranosyl group. The compound exhibits antioxidant properties and may have potential applications in pharmaceuticals and cosmetics, particularly for its anti-inflammatory and skin-soothing effects. Its structure allows for interactions with various biological systems, making it of interest in research related to plant biochemistry and medicinal chemistry. Additionally, it may be involved in plant defense mechanisms and has been studied for its potential health benefits in humans. As with many phenolic compounds, it may also exhibit antimicrobial activity.
Formula:C13H16O9
InChI:InChI=1S/C13H16O9/c14-4-8-9(16)10(17)11(18)13(22-8)21-7-2-1-5(15)3-6(7)12(19)20/h1-3,8-11,13-18H,4H2,(H,19,20)/t8-,9-,10+,11-,13-/m1/s1
InChI key:InChIKey=GEZJVEGHJRPQEX-BZNQNGANSA-N
SMILES:O(C1=C(C(O)=O)C=C(O)C=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- Orbicularin
- Benzoic acid, 2-(β-D-glucopyranosyloxy)-5-hydroxy-
- 2-(β-D-Glucopyranosyloxy)-5-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-O-β-4C1-Glucopyranoside-2,5-dihydroxybenzoic acid
CAS:<p>2-O-beta-4C1-Glucopyranoside-2,5-dihydroxybenzoic acid is a glycoside compound, which is a type of structural derivative where a sugar moiety is bonded to a non-carbohydrate functional group or aglycone. It is derived from specific plant or microbial sources through biochemical synthesis or extraction. The mode of action involves the hydrolysis of the glycosidic bond, mediated by specific enzymes, which releases the aglycone and the sugar component. This feature is crucial for its role in metabolic pathways where sugars are utilized or modified.<br><br>In scientific research, this compound is used in studying carbohydrate metabolism and enzyme activity, particularly those involving glycosidases. Due to its structural characteristics, it may serve as a model compound in understanding glycoside biosynthesis and degradation processes. Additionally, its potential applications in pharmaceuticals are being explored, especially in designing drugs that target enzymatic pathways. The compound's unique structure and reactivity make it a valuable tool in the field of biochemistry and molecular biology, offering insights into glycosidic bond interactions and transformations.</p>Formula:C13H16O9Purity:Min. 95%Molecular weight:316.26 g/mol
