CAS 98105-45-4
:N-T-boc-5-cyclohexylstatine
Description:
N-T-boc-5-cyclohexylstatine is a chemical compound that belongs to the class of statins, which are primarily used for their cholesterol-lowering properties. The "N-T-boc" designation indicates that the compound has a tert-butyloxycarbonyl (Boc) protecting group, commonly used in organic synthesis to protect amines during reactions. The presence of the cyclohexyl group suggests that the compound has a cyclic hydrocarbon structure, which may influence its biological activity and lipophilicity. Statins typically function by inhibiting HMG-CoA reductase, an enzyme involved in cholesterol biosynthesis, thereby reducing cholesterol levels in the body. The specific structural features of N-T-boc-5-cyclohexylstatine may contribute to its potency and selectivity as a statin. Additionally, the compound's solubility, stability, and pharmacokinetic properties would be essential for its application in medicinal chemistry. As with many statins, potential side effects and interactions with other medications should be considered in therapeutic contexts.
Formula:C16H29NO5
InChI:InChI=1/C16H29NO5/c1-16(2,3)22-15(21)17-12(13(18)10-14(19)20)9-11-7-5-4-6-8-11/h11-13,18H,4-10H2,1-3H3,(H,17,21)(H,19,20)/t12-,13-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CC1CCCCC1)[C@H](CC(=O)O)O)O
Synonyms:- Boc-cyclohexylstatine
- (3S,4S)-4-(Boc-amino)-5-cyclohexyl-3-hydroxy-pentanoic acid
- 4-[(tert-butoxycarbonyl)amino]-5-cyclohexyl-2,4,5-trideoxy-L-threo-pentonic acid
- Boc-ACHPA
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boc-(3S,4S)-4-amino-3-hydroxy-5-cyclohexylpentanoic Acid
CAS:Controlled ProductFormula:C16H29NO5Color and Shape:NeatMolecular weight:482.193
