
CAS 98112-41-5
:Brevetoxin A
Description:
Brevetoxin A is a potent neurotoxin produced by certain species of marine dinoflagellates, particularly Karenia brevis, which is responsible for harmful algal blooms known as red tides. This compound is classified as a polyether and is characterized by its complex molecular structure, which includes multiple ether linkages and a cyclic arrangement. Brevetoxin A exhibits high affinity for voltage-gated sodium channels in nerve cells, leading to prolonged depolarization and disruption of normal neuronal signaling. This mechanism is responsible for its toxic effects, which can result in neurotoxic shellfish poisoning in humans and other marine organisms. The substance is lipophilic, allowing it to accumulate in marine food webs, and is resistant to degradation in the marine environment. Due to its toxicity, brevetoxin A poses significant risks to marine life and human health, particularly for those consuming contaminated seafood. Monitoring and management of brevetoxin levels are crucial in areas prone to algal blooms to mitigate health risks and environmental impacts.
Formula:C49H70O13
InChI:InChI=1S/C49H70O13/c1-26-17-36-39(22-45(52)58-36)57-44-21-38-40(62-48(44,4)23-26)18-28(3)46-35(55-38)11-7-6-10-31-32(59-46)12-8-14-34-33(54-31)13-9-15-43-49(5,61-34)24-42-37(56-43)20-41-47(60-42)30(51)19-29(53-41)16-27(2)25-50/h6-8,14,25-26,28-44,46-47,51H,2,9-13,15-24H2,1,3-5H3/b7-6-,14-8?/t26-,28+,29-,30+,31-,32+,33+,34-,35+,36+,37+,38-,39-,40+,41-,42-,43-,44+,46-,47+,48-,49+/m1/s1
InChI key:InChIKey=MGVIMUPHKPHTKF-OWZZQVFLSA-N
SMILES:C[C@]12C[C@@]3([C@@](O[C@@]1(CCC[C@]4([C@](O2)(C=CC[C@]5([C@](O4)(C/C=C\C[C@]6([C@](O5)([C@@H](C)C[C@]7([C@](O6)(C[C@]8([C@](C)(O7)C[C@H](C)C[C@]9([C@](O8)(CC(=O)O9)[H])[H])[H])[H])[H])[H])[H])[H])[H])[H])[H])[H])(C[C@@]%10([C@@](O3)([C@@H](O)C[C@@H](CC(C=O)=C)O%10)[H])[H])[H])[H]
Synonyms:- Ptychodiscusbrevis toxin 1
- GB 1
- Brevetoxin A
- Brevetoxin PbTx 1
- PbTx 1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Brevetoxin A
CAS:Brevetoxin A is a naturally occurring neurotoxin, which is produced by the marine dinoflagellate *Karenia brevis*. This microorganism is commonly associated with harmful algal blooms known as "red tides." Brevetoxin A exerts its biological effects by binding to voltage-gated sodium channels in nerve cells, causing persistent activation. This disrupts normal neuronal signaling, leading to the excitation and, eventually, the failure of affected nerve cells.
Formula:C49H70O13Purity:Min. 95%Molecular weight:867.1 g/mol
