CAS 98133-47-2

2,4-Bis(acetyloxy)-N-[3-(acetyloxy)propyl]-3,3-dimethylbutanamide

Description:

2,4-Bis(acetyloxy)-N-[3-(acetyloxy)propyl]-3,3-dimethylbutanamide, identified by its CAS number 98133-47-2, is a synthetic organic compound characterized by its complex structure featuring multiple acetyloxy groups and a dimethylbutanamide backbone. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of acetyloxy functional groups, which can participate in esterification or hydrolysis reactions. The presence of multiple acetyl groups suggests that it may have applications in medicinal chemistry or as a precursor in organic synthesis. Additionally, the branched structure of the dimethylbutanamide moiety may influence its steric properties and biological activity. As with many synthetic compounds, safety data and handling precautions should be considered, as the specific toxicity and environmental impact of this compound are not widely documented. Overall, its unique structure may offer interesting avenues for research and application in various chemical fields.

Formula: C₁₅H₂₅NO₇

InChI: InChI=1S/C15H25NO7/c1-10(17)21-8-6-7-16-14(20)13(23-12(3)19)15(4,5)9-22-11(2)18/h13H,6-9H2,1-5H3,(H,16,20)

InChI key: InChIKey=IFYVAPPYWOMVDP-UHFFFAOYSA-N

SMILES: C(C(COC(C)=O)(C)C)(C(NCCCOC(C)=O)=O)OC(C)=O

Synonyms:

• 2,4-Bis(acetyloxy)-N-[3-(acetyloxy)propyl]-3,3-dimethylbutanamide
• Butanamide, 2,4-bis(acetyloxy)-N-[3-(acetyloxy)propyl]-3,3-dimethyl-
• D-Panthenyl triacetate
• Butyramide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, triacetate