CAS 98134-36-2
:6-Chloro-2-ethyl-4-pyrimidinamine
Description:
6-Chloro-2-ethyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a chlorine atom at the 6-position and an ethyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the amino group. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, 6-Chloro-2-ethyl-4-pyrimidinamine is of interest in medicinal chemistry for its potential applications in drug development.
Formula:C6H8ClN3
InChI:InChI=1S/C6H8ClN3/c1-2-6-9-4(7)3-5(8)10-6/h3H,2H2,1H3,(H2,8,9,10)
InChI key:InChIKey=UNSVPHMKJQIBCH-UHFFFAOYSA-N
SMILES:C(C)C=1N=C(Cl)C=C(N)N1
Synonyms:- 4-Pyrimidinamine, 6-Chloro-2-Ethyl-
- 6-Chloro-2-ethyl-4-pyrimidinamine
- Pyrimidine, 4-amino-6-chloro-2-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
