
CAS 98134-79-3
:1-(2-Amino-5-thiazolyl)-1-propanone
Description:
1-(2-Amino-5-thiazolyl)-1-propanone, identified by its CAS number 98134-79-3, is a chemical compound characterized by the presence of a thiazole ring and an amino group. This compound typically exhibits properties associated with both amines and ketones, which can influence its reactivity and interactions in various chemical environments. The thiazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. It may participate in hydrogen bonding due to the amino group, enhancing its solubility in polar solvents. Additionally, the presence of the carbonyl group in the propanone structure can facilitate nucleophilic attacks, making it a versatile intermediate in organic synthesis. The compound's stability, solubility, and reactivity can vary based on the specific conditions, such as pH and temperature. Overall, 1-(2-Amino-5-thiazolyl)-1-propanone is a compound of interest for its potential applications in pharmaceuticals and organic synthesis.
Formula:C6H8N2OS
InChI:InChI=1S/C6H8N2OS/c1-2-4(9)5-3-8-6(7)10-5/h3H,2H2,1H3,(H2,7,8)
InChI key:InChIKey=UNUBBIGYXDAEDF-UHFFFAOYSA-N
SMILES:C(CC)(=O)C=1SC(N)=NC1
Synonyms:- 1-(2-Amino-1,3-thiazol-5-yl)propan-1-one
- 1-Propanone, 1-(2-amino-5-thiazolyl)-
- 1-(2-Amino-5-thiazolyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.