
CAS 98135-11-6
:N-[5-(Methylsulfonyl)-2-thiazolyl]acetamide
Description:
N-[5-(Methylsulfonyl)-2-thiazolyl]acetamide, with the CAS number 98135-11-6, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methylsulfonyl group, which contributes to its solubility and reactivity, making it useful in various chemical applications. The acetamide functional group indicates the presence of an amide bond, which can influence the compound's biological activity and interactions. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, making them of interest in pharmaceutical research. The presence of both the thiazole and sulfonyl groups can enhance the compound's ability to interact with biological targets. Additionally, its stability and solubility in polar solvents are important characteristics that can affect its application in synthesis and drug formulation. Overall, N-[5-(Methylsulfonyl)-2-thiazolyl]acetamide is a compound with potential utility in medicinal chemistry and related fields.
Formula:C6H8N2O3S2
InChI:InChI=1S/C6H8N2O3S2/c1-4(9)8-6-7-3-5(12-6)13(2,10)11/h3H,1-2H3,(H,7,8,9)
InChI key:InChIKey=YTZYOXUDTCMMEO-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1SC(NC(C)=O)=NC1
Synonyms:- N-[5-(Methylsulfonyl)-2-thiazolyl]acetamide
- Thiazole, 2-acetamido-5-(methylsulfonyl)-
- Acetamide, N-[5-(methylsulfonyl)-2-thiazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.