CAS 98135-37-6

3-(Aminomethyl)-2-pyrazinecarboxamide

Description:

3-(Aminomethyl)-2-pyrazinecarboxamide, with the CAS number 98135-37-6, is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an aminomethyl group and a carboxamide functional group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the amino group suggests that it may exhibit basic properties, while the carboxamide group can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may be investigated for their biological activity, including potential roles as pharmaceuticals or agrochemicals. The molecular structure allows for various interactions, making it a candidate for studies in drug design or as a ligand in coordination chemistry. Its stability, reactivity, and solubility in different solvents would depend on the specific conditions and the presence of other functional groups in a given reaction or application.

Formula: C₆H₈N₄O

InChI: InChI=1S/C6H8N4O/c7-3-4-5(6(8)11)10-2-1-9-4/h1-2H,3,7H2,(H2,8,11)

InChI key: InChIKey=UHHOBYQQJQDVHQ-UHFFFAOYSA-N

SMILES: C(N)C=1C(C(N)=O)=NC=CN1

Synonyms:

• Pyrazinamide, 3-aminomethyl-
• 3-(Aminomethyl)-2-pyrazinecarboxamide
• 2-Pyrazinecarboxamide, 3-(aminomethyl)-