
CAS 98136-13-1
:1-Carboxyethyl 2-propenoate
Description:
1-Carboxyethyl 2-propenoate, also known as acrylic acid 2-carboxyethyl ester, is an organic compound characterized by its functional groups, which include both a carboxylic acid and an ester. This compound typically appears as a colorless to pale yellow liquid with a characteristic acrid odor. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of the propenoate group indicates that it can undergo polymerization, which is a key feature for its use in the production of polymers and copolymers. This compound is often utilized in the synthesis of various materials, including adhesives, coatings, and textiles, due to its ability to enhance properties such as adhesion and flexibility. Additionally, it may exhibit reactivity under certain conditions, making it important to handle with care, as it can be a skin and eye irritant. Overall, 1-Carboxyethyl 2-propenoate is significant in industrial applications, particularly in the field of polymer chemistry.
Formula:C6H8O4
InChI:InChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9/h3-4H,1H2,2H3,(H,8,9)
InChI key:InChIKey=CUTWSDAQYCQTGD-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)C)C(C=C)=O
Synonyms:- 2-Acryloyloxypropionic acid
- 1-Carboxyethyl 2-propenoate
- 2-(Acryloyloxy)propanoic acid
- 2-Propenoic acid, 1-carboxyethyl ester
- Lactic acid, acrylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.