CAS 98137-00-9
:2-Bromo-2,2-dichloroacetamide
Description:
2-Bromo-2,2-dichloroacetamide is an organic compound characterized by its halogenated acetamide structure. It features a bromine atom and two chlorine atoms attached to the carbon adjacent to the amide functional group, which contributes to its reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and is known for its stability under standard conditions, although it may decompose under extreme heat or in the presence of strong bases or acids. 2-Bromo-2,2-dichloroacetamide is often utilized in organic synthesis, particularly in the preparation of other halogenated compounds and as a reagent in various chemical reactions. Its unique halogen substituents can influence its biological activity, making it of interest in medicinal chemistry and agrochemical research. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds. Proper safety protocols should be followed when working with this chemical.
Formula:C2H2BrCl2NO
InChI:InChI=1S/C2H2BrCl2NO/c3-2(4,5)1(6)7/h(H2,6,7)
InChI key:InChIKey=BYGNVSUVJJULOS-UHFFFAOYSA-N
SMILES:C(C(N)=O)(Br)(Cl)Cl
Synonyms:- Acetamide, 2-bromo-2,2-dichloro-
- 2-Bromo-2,2-dichloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromo-2,2-dichloroacetamide
CAS:Controlled Product<p>Applications 2-Bromo-2,2-dichloroacetamide is a byproduct produced from water purifciation processes.<br>References Chuang, Y. et al.: Env. Sci. Tech., 53, 3729 (2019)<br></p>Formula:C2H2BrCl2NOColor and Shape:White To Off-WhiteMolecular weight:206.853
