CAS 98138-26-2

3-(dimethylamino)-N'-hydroxypropanimidamide

Description:

3-(Dimethylamino)-N'-hydroxypropanimidamide, with the CAS number 98138-26-2, is a chemical compound characterized by its unique functional groups, including a dimethylamino group and a hydroxypropanimidamide structure. This compound typically exhibits properties associated with amines and amides, such as potential basicity due to the presence of the dimethylamino group, which can participate in hydrogen bonding. The hydroxy group contributes to its solubility in polar solvents, making it more amenable to interactions in biological systems. The presence of the imidamide functional group suggests potential reactivity in various chemical reactions, including those involving nucleophiles or electrophiles. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Overall, the characteristics of 3-(dimethylamino)-N'-hydroxypropanimidamide position it as a versatile compound in both synthetic and biological chemistry contexts.

Formula: C₅H₁₃N₃O

InChI: InChI=1/C5H13N3O/c1-8(2)4-3-5(6)7-9/h9H,3-4H2,1-2H3,(H2,6,7)

SMILES: CN(C)CCC(=N)NO

Synonyms:

• (1Z)-3-(dimethylamino)-N'-hydroxypropanimidamide

(1Z)-3-(Dimethylamino)-N'-hydroxypropanimidamide

CAS: 98138-26-2

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 131.1790008544922

Ref: 10-F061512