CymitQuimica logo

CAS 98140-74-0

:

4-Methyl-5-oxazoleacetic acid

Description:
4-Methyl-5-oxazoleacetic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group at the 4-position and an acetic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities. Its structure allows for interactions with biological systems, making it a candidate for further research in drug development. Additionally, 4-Methyl-5-oxazoleacetic acid may exhibit specific reactivity patterns typical of carboxylic acids and heterocycles, which can be exploited in synthetic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H7NO3
InChI:InChI=1S/C6H7NO3/c1-4-5(2-6(8)9)10-3-7-4/h3H,2H2,1H3,(H,8,9)
InChI key:InChIKey=VIWXWDZRRIYDLM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C)N=CO1
Synonyms:
  • 4-Methyl-5-oxazoleacetic acid
  • 2-(4-Methyl-1,3-oxazol-5-yl)acetic acid
  • 5-Oxazoleacetic acid, 4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.