CAS 98140-96-6
:Methyl 6-aminopyridazine-3-carboxylate
Description:
Methyl 6-aminopyridazine-3-carboxylate is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylate group and an amino group, contributing to its reactivity and potential applications in medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic processes. Methyl 6-aminopyridazine-3-carboxylate may exhibit biological activity, which can be explored for pharmaceutical applications, particularly in the development of new drugs. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in areas such as enzyme inhibition or receptor modulation. Additionally, the presence of both amino and carboxylate groups suggests that it can participate in various chemical reactions, including esterification and amination, which are valuable in organic synthesis. Overall, this compound's unique structural features and functional groups make it an interesting subject for further study in both synthetic and medicinal chemistry.
Formula:C6H7N3O2
InChI:InChI=1/C6H7N3O2/c1-11-6(10)4-2-3-5(7)9-8-4/h2-3H,1H3,(H2,7,9)
SMILES:COC(=O)c1ccc(=N)[nH]n1
Synonyms:- 3-Pyridazinecarboxylic acid, 6-amino-, methyl ester
- Methyl 6-amino-3-pyridazinecarboxylate
- Methyl 3-aminopyridazine-6-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
methyl 6-aminopyridazine-3-carboxylate
CAS:Formula:C6H7N3O2Purity:96%Color and Shape:SolidMolecular weight:153.1387Methyl 3-aminopyridazine-6-carboxylate hydrochloride
CAS:Methyl 3-aminopyridazine-6-carboxylate hydrochloridePurity:97%Molecular weight:189.59962g/molMethyl 6-aminopyridazine-3-carboxylate
CAS:Formula:C6H7N3O2Purity:96%Color and Shape:SolidMolecular weight:153.141Methyl 6-aminopyridazine-3-carboxylate
CAS:Controlled ProductApplications Methyl 6-aminopyridazine-3-carboxylate
Formula:C6H7N3O2Color and Shape:NeatMolecular weight:153.14Methyl 6-aminopyridazine-3-carboxylate
CAS:Versatile small molecule scaffoldFormula:C6H7N3O2Purity:Min. 95%Molecular weight:153.14 g/mol





