CAS 98166-25-7
:2,3,4,5-tetrahydropyrano[3,2-b]indole
Description:
2,3,4,5-Tetrahydropyrano[3,2-b]indole is a bicyclic compound that features a fused indole and pyran structure. This substance is characterized by its unique arrangement of carbon and nitrogen atoms, which contributes to its potential biological activity. The compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, although its solubility in water is limited. It may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The presence of the indole moiety often correlates with various biological activities, including antimicrobial and anticancer effects. Additionally, the tetrahydropyran ring can influence the compound's reactivity and interaction with biological targets. As with many organic compounds, its stability can be affected by environmental factors such as light and temperature. Overall, 2,3,4,5-tetrahydropyrano[3,2-b]indole represents a fascinating area of study for researchers exploring novel therapeutic agents.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-2-5-9-8(4-1)11-10(12-9)6-3-7-13-11/h1-2,4-5,12H,3,6-7H2
Synonyms:- 2,3,4,5-Tetrahydropyrano[3,2-b]indole
- pyrano[3,2-b]indole, 2,3,4,5-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
