CAS 98169-56-3
:(4R)-2-Thioxo-4-thiazolidinecarboxylic acid
Description:
(4R)-2-Thioxo-4-thiazolidinecarboxylic acid, with CAS number 98169-56-3, is a sulfur-containing heterocyclic compound characterized by its thiazolidine ring structure. This compound features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The stereochemistry denoted by the (4R) configuration suggests that it has a specific three-dimensional arrangement, which can affect its interactions with biological targets, potentially making it relevant in medicinal chemistry. Compounds of this type are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. Additionally, the thiazolidine framework is of interest in the synthesis of various bioactive molecules, making it a valuable compound in organic synthesis and drug development. Overall, (4R)-2-Thioxo-4-thiazolidinecarboxylic acid represents a unique structure with potential applications in both research and therapeutic contexts.
Formula:C4H5NO2S2
InChI:InChI=1S/C4H5NO2S2/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1
InChI key:InChIKey=SQUOCHQOQMZGQP-REOHCLBHSA-N
SMILES:C(O)(=O)[C@H]1NC(=S)SC1
Synonyms:- (4R)-(-)-2-thioxo-4-thiazolidinecarboxylic acid,
- (4R)-2-Sulfanylidene-1,3-thiazolidine-4-carboxylic acid
- (4R)-2-thioxo-1,3-thiazolidine-4-carboxylic acid
- (R)-()-2-Thioxo-4-thiazolidinecarboxylic acid
- (R)-(-)-Thiazolidine-2-thione-4-carboxylic acid
- 4-Thiazolidinecarboxylic acid, 2-thioxo-, (4R)-
- 4-Thiazolidinecarboxylic acid, 2-thioxo-, (R)-
- Raphanusamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(4R)-()-2-Thioxo-4-thiazolidinecarboxylic acid
CAS:Formula:C4H5NO2S2Purity:95%Color and Shape:SolidMolecular weight:163.2180(R)-2-Thioxothiazolidine-4-carboxylic acid
CAS:(R)-2-Thioxothiazolidine-4-carboxylic acidPurity:95%Molecular weight:163.22g/mol(R)-2-Thioxothiazolidine-4-carboxylic Acid
CAS:Controlled ProductFormula:C4H5NO2S2Color and Shape:NeatMolecular weight:163.22(4R)-(-)-2-Thioxo-4-thiazolidinecarboxylic acid
CAS:<p>(4R)-(-)-2-Thioxo-4-thiazolidinecarboxylic acid is a metabolite of the drug diazepam. It has been shown to inhibit DNA polymerase and human prostate cancer cells in vitro, but not in vivo. In addition, it has been found to be an analytical method for detecting diazepam metabolites in urine. The drug is used as a biomarker for monitoring the pharmacokinetics of diazepam and its active form N-desmethyldiazepam. (4R)-(-)-2-Thioxo-4-thiazolidinecarboxylic acid can also be used as a potential biomarker for assessing response to chemotherapy treatment.</p>Formula:C4H5NO2S2Purity:Min. 95%Color and Shape:PowderMolecular weight:163.22 g/mol





