CAS 98181-63-6
:[9-(2,5-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium,[9-(2,6-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium,dichloride
Description:
The chemical substance with the name "[9-(2,5-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium,[9-(2,6-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium,dichloride" and CAS number 98181-63-6 is a complex organic compound characterized by its xanthene core structure, which is modified by the presence of dimethylamino groups and dicarboxyphenyl substituents. This compound exhibits properties typical of xanthene derivatives, including potential applications in dye chemistry and fluorescence. The presence of dimethylamino groups suggests that it may have enhanced electron-donating properties, which can influence its optical characteristics. The dicarboxyphenyl groups contribute to the compound's solubility and reactivity, making it suitable for various chemical applications. Additionally, the dichloride form indicates that the compound may exist as a salt, which can affect its stability and solubility in different solvents. Overall, this compound is of interest in fields such as organic synthesis, materials science, and photochemistry due to its unique structural features and potential functional properties.
Formula:C50H46Cl2N4O10
InChI:InChI=1/2C25H22N2O5.2ClH/c1-26(2)15-6-9-18-21(12-15)32-22-13-16(27(3)4)7-10-19(22)23(18)20-11-14(24(28)29)5-8-17(20)25(30)31;1-26(2)14-8-10-16-20(12-14)32-21-13-15(27(3)4)9-11-17(21)22(16)23-18(24(28)29)6-5-7-19(23)25(30)31;;/h2*5-13H,1-4H3,(H-,28,29,30,31);2*1H
SMILES:CN(C)c1ccc2c(c1)[o+]c1cc(ccc1c2c1cc(ccc1C(=O)[O-])C(=O)O)N(C)C.CN(C)c1ccc2c(c1)[o+]c1cc(ccc1c2c1c(cccc1C(=O)[O-])C(=O)O)N(C)C.Cl.Cl
Synonyms:- [9-(2,6-Dicarboxyphenyl)-6-(Dimethylamino)Xanthen-3-Ylidene]-Dimethyl-Ammonium, Dichloride
- 5(5)-Tamra
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5(6)-Carboxy-tetramethylrhodamine
CAS:Mixture of 5- and 6-TAMRA (TMR). Often used fluorophore for labeling peptides and proteins. CAS Number (spiro form) 50347-56-1.Formula:C25H22N2O5Purity:> 93%Color and Shape:Purple PowderMolecular weight:430.465(6)-Carboxy-tetramethylrhodamine
CAS:Formula:C25H23DN2O5Purity:99%Color and Shape:SolidMolecular weight:433.47465(6)-TAMRA
CAS:5(6)-TAMRA is a bright orange dye reacting with amines, with ~555/580 nm absorption/emission.Formula:C50H44N4O10Purity:97.44%Color and Shape:SolidMolecular weight:860.925(6)-Carboxytetramethylrhodamine
CAS:5(6)-CarboxytetramethylrhodaminePurity:95%Color and Shape:SolidMolecular weight:860.91g/mol5-(6)-Carboxytetramethylrhodamine
CAS:5-(6)-Carboxytetramethylrhodamine (TAMRA) is a fluorescent dye that is used as a probe for DNA-based analysis. It binds to the 5' end of dsDNA, forming an intrastrand duplex. The fluorescence of TAMRA increases when it binds to dsDNA and can be used as a measure of the amount of DNA in a sample. TAMRA has been shown to be useful in the diagnosis of bowel disease and in the investigation of gene expression during body formation. This dye is also used as a marker for covalent linkages and high molecular weight proteins such as cyclin D2.Formula:C25H22N2O5Purity:Min. 95 Area-%Color and Shape:Red PowderMolecular weight:430.45 g/mol5(6)-Carboxytetramethylrhodamine (Technical Grade)
CAS:Controlled ProductFormula:C25H22N2O5Color and Shape:NeatMolecular weight:430.45







