CAS 98183-15-4

2-[(1-Acetyl-2-oxopropyl)thio]-N-cyclohexyl-1H-benzimidazole-1-carboxamide

Description:

2-[(1-Acetyl-2-oxopropyl)thio]-N-cyclohexyl-1H-benzimidazole-1-carboxamide, with the CAS number 98183-15-4, is a chemical compound that belongs to the class of benzimidazole derivatives. This compound typically exhibits a complex structure characterized by the presence of a benzimidazole ring, which is known for its biological activity, particularly in medicinal chemistry. The presence of a thioether group and an acetyl moiety suggests potential reactivity and interactions with biological targets. It may possess properties such as antimicrobial, antifungal, or anticancer activities, although specific biological activities would depend on further empirical studies. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many synthetic organic compounds, safety data should be consulted to assess toxicity and handling precautions. Overall, this compound represents a potentially valuable scaffold for drug development and research in medicinal chemistry.

Formula: C₁₉H₂₃N₃O₃S

InChI: InChI=1/C19H23N3O3S/c1-12(23)17(13(2)24)26-19-21-15-10-6-7-11-16(15)22(19)18(25)20-14-8-4-3-5-9-14/h6-7,10-11,14,17H,3-5,8-9H2,1-2H3,(H,20,25)

SMILES: CC(=O)C(C(=O)C)Sc1nc2ccccc2n1C(=NC1CCCCC1)O