CAS 98195-39-2

Decane-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-d21, 10-bromo-

Description:

Decane-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-d21, 10-bromo- is a brominated alkane, specifically a derivative of decane, which is a straight-chain hydrocarbon with ten carbon atoms. The presence of multiple deuterium (d21) atoms indicates that this compound is isotopically labeled, which can be useful in various chemical and biological studies, particularly in tracing and tracking reactions. The bromine atom introduces a halogen functionality, which can significantly influence the compound's reactivity, making it more susceptible to nucleophilic substitution reactions. This compound is likely to be a colorless liquid at room temperature, exhibiting typical characteristics of alkanes, such as low solubility in water but higher solubility in organic solvents. Its physical and chemical properties, including boiling point and density, would be influenced by the bromine substitution and the presence of deuterium. As with many brominated compounds, it may also have implications for environmental and health safety, necessitating careful handling and disposal.

Formula: C₁₀BrD₂₁

InChI: InChI=1S/C10H21Br/c1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2

InChI key: InChIKey=MYMSJFSOOQERIO-SLBGAMDCSA-N

SMILES: C(C(C(C(C(Br)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])(C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]

Synonyms:

• Decane-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-d21, 10-bromo-
• 1-Bromodecane-d21

1-Bromodecane-d21

CAS: 98195-39-2

Formula: CD₃(CD₂)₉Br

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 241.21447

Ref: 3U-D0517

1-Bromodecane-d21

Controlled Product

CAS: 98195-39-2

Applications 1-Bromodecane-d21 (CAS# 98195-39-2) is a useful isotopically labeled research compound.

Formula: C₁₀D₂₁Br

Color and Shape: Neat

Molecular weight: 242.31

Ref: TR-B682841