
CAS 98196-98-6
:4-[(Carboxycarbonyl)amino]butanoic acid
Description:
4-[(Carboxycarbonyl)amino]butanoic acid, also known as a derivative of amino acids, is characterized by its structure that includes both carboxylic acid and amine functional groups. This compound features a four-carbon backbone with a carboxycarbonyl group attached to the amino group, which contributes to its properties as an amino acid derivative. It is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. The compound can participate in various chemical reactions, including peptide bond formation, making it relevant in biochemical applications and research. Its molecular structure allows it to act as a building block for peptides and proteins, and it may exhibit biological activity, potentially influencing metabolic pathways. Additionally, the presence of both carboxylic and amino groups suggests that it can act as a zwitterion in solution, impacting its behavior in biological systems. Overall, 4-[(Carboxycarbonyl)amino]butanoic acid is significant in the fields of organic chemistry and biochemistry.
Formula:C6H9NO5
InChI:InChI=1S/C6H9NO5/c8-4(9)2-1-3-7-5(10)6(11)12/h1-3H2,(H,7,10)(H,8,9)(H,11,12)
InChI key:InChIKey=ZFSRSSWMUOQXDN-UHFFFAOYSA-N
SMILES:N(CCCC(O)=O)C(C(O)=O)=O
Synonyms:- Butanoic acid, 4-[(carboxycarbonyl)amino]-
- 4-[(Carboxycarbonyl)amino]butanoic acid
- Oxamic acid, (3-carboxypropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.