CAS 98197-88-7

(4-nitropyridin-2-yl)methanol

Description:

(4-Nitropyridin-2-yl)methanol is an organic compound characterized by the presence of a pyridine ring substituted with a nitro group and a hydroxymethyl group. The molecular structure features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, specifically at the 2-position, with a nitro group (-NO2) attached at the 4-position. This compound exhibits polar characteristics due to the hydroxymethyl (-CH2OH) group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The nitro group contributes to the compound's electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis and medicinal chemistry. (4-Nitropyridin-2-yl)methanol may also exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 98197-88-7, allows for easy identification in chemical databases. Overall, this compound's unique structural features and functional groups make it a valuable subject of study in various chemical contexts.

Formula: C₆H₆N₂O₃

InChI: InChI=1/C6H6N2O3/c9-4-5-3-6(8(10)11)1-2-7-5/h1-3,9H,4H2

SMILES: c1cnc(cc1N(=O)=O)CO

Synonyms:

• 2-Pyridinemethanol, 4-Nitro-

(4-nitropyridin-2-yl)methanol

CAS: 98197-88-7

Formula: C₆H₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1234

Ref: IN-DA003F2I

(4-nitropyridin-2-yl)methanol

CAS: 98197-88-7

(4-nitropyridin-2-yl)methanol

Purity: 95%

Molecular weight: 154.12g/mol

Ref: 54-OR901944

(4-Nitropyridin-2-yl)methanol

CAS: 98197-88-7

Formula: C₆H₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.125

Ref: 10-F233673