CymitQuimica logo

CAS 982-06-9

:

(3β)-3-(Acetyloxy)-16-methylpregna-5,16-dien-20-one

Description:
The chemical substance known as (3β)-3-(Acetyloxy)-16-methylpregna-5,16-dien-20-one, with the CAS number 982-06-9, is a synthetic steroid that belongs to the class of progestins. It is characterized by its structural features, including a pregnane backbone with specific functional groups such as an acetoxy group at the 3β position and a double bond between the 5 and 16 positions. This compound exhibits hormonal activity, primarily functioning as a progestogen, which means it plays a crucial role in regulating various physiological processes, including the menstrual cycle and pregnancy. Its lipophilic nature allows it to easily penetrate cell membranes, interacting with progesterone receptors to exert its biological effects. The compound is often utilized in pharmaceutical formulations, particularly in contraceptives and hormone replacement therapies. Due to its specific structural modifications, it may exhibit distinct pharmacokinetic properties and potency compared to other steroids, making it a subject of interest in both medicinal chemistry and endocrinology.
Formula:C24H34O3
InChI:InChI=1S/C24H34O3/c1-14-12-21-19-7-6-17-13-18(27-16(3)26)8-10-23(17,4)20(19)9-11-24(21,5)22(14)15(2)25/h6,18-21H,7-13H2,1-5H3/t18-,19+,20-,21-,23-,24-/m0/s1
InChI key:InChIKey=NELMHAIFXJZDST-HHNLCZHGSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(=CC3)C[C@@H](OC(C)=O)CC4)(CC1)[H])[H])(CC(C)=C2C(C)=O)[H]
Synonyms:
  • 5,16-Pregnadien-16-methyl-3β-ol-20-one acetate
  • Pregna-5,16-dien-20-one, 3β-hydroxy-16-methyl-, acetate
  • Pregna-5,16-dien-20-one, 3-(acetyloxy)-16-methyl-, (3β)-
  • (3β)-3-(Acetyloxy)-16-methylpregna-5,16-dien-20-one
  • 3β-Acetoxy-16-methylpregna-5,16-dien-20-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.