CAS 98212-93-2

(2E,4S)-4-amino-5-fluoropent-2-enoic acid

Description:

(2E,4S)-4-amino-5-fluoropent-2-enoic acid, also known as a fluorinated amino acid, is characterized by its unique structural features that include a double bond and a fluorine atom attached to the carbon chain. This compound contains an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. The presence of the fluorine atom can influence the compound's reactivity, stability, and biological activity, potentially enhancing its properties compared to non-fluorinated analogs. The stereochemistry indicated by the (2E,4S) notation suggests specific spatial arrangements of the atoms, which can affect the compound's interactions in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs that target specific biological pathways or in the study of metabolic processes. Its unique characteristics make it a valuable subject for further investigation in medicinal chemistry and biochemistry.

Formula: C₅H₈FNO₂

InChI: InChI=1/C5H8FNO2/c6-3-4(7)1-2-5(8)9/h1-2,4H,3,7H2,(H,8,9)/b2-1+/t4-/m0/s1