
CAS 98263-37-7
:7-Methoxy-4-isoquinolinol
Description:
7-Methoxy-4-isoquinolinol is a chemical compound characterized by its isoquinoline structure, which features a methoxy group (-OCH3) at the 7-position and a hydroxyl group (-OH) at the 4-position of the isoquinoline ring. This compound is typically classified as an alkaloid and may exhibit various biological activities, including potential neuroprotective and anti-inflammatory properties. Its molecular structure contributes to its solubility and reactivity, making it of interest in medicinal chemistry and pharmacology. The presence of the methoxy group can influence its lipophilicity, potentially affecting its absorption and distribution in biological systems. Additionally, the compound may participate in various chemical reactions, such as oxidation or substitution, due to the functional groups present. As with many isoquinoline derivatives, 7-Methoxy-4-isoquinolinol may also be studied for its interactions with biological targets, which could lead to the development of therapeutic agents. However, specific studies and data on its pharmacokinetics and toxicity would be necessary for a comprehensive understanding of its characteristics and potential applications.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-13-8-2-3-9-7(4-8)5-11-6-10(9)12/h2-6,12H,1H3
InChI key:InChIKey=XESUFICKKITLKB-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(OC)C=C2)C=NC1
Synonyms:- 4-Isoquinolinol, 7-methoxy-
- 7-Methoxy-4-isoquinolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.