
CAS 98276-74-5
:N-(4-Acetyl-2-thiazolyl)acetamide
Description:
N-(4-Acetyl-2-thiazolyl)acetamide, with the CAS number 98276-74-5, is an organic compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features an acetyl group and an acetamide functional group, making it a derivative of thiazole. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the thiazole moiety often imparts unique chemical properties, such as potential antimicrobial or antifungal activity, which can be explored in pharmaceutical applications. The compound's molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, its synthesis may involve standard organic reactions, such as acylation and condensation, making it accessible for research and development in medicinal chemistry. Overall, N-(4-Acetyl-2-thiazolyl)acetamide is of interest for its potential applications in drug development and its role in biological systems.
Formula:C7H8N2O2S
InChI:InChI=1S/C7H8N2O2S/c1-4(10)6-3-12-7(9-6)8-5(2)11/h3H,1-2H3,(H,8,9,11)
InChI key:InChIKey=SBYHBPURQORCFO-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=NC(C(C)=O)=CS1
Synonyms:- Acetamide, N-(4-acetyl-2-thiazolyl)-
- Ketone, 2-acetamido-4-thiazolyl methyl
- N-(4-Acetyl-2-thiazolyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.