CAS 98278-52-5
:2-ethylbutanethioamide
Description:
2-Ethylbutanethioamide, with the CAS number 98278-52-5, is an organic compound characterized by the presence of a thioamide functional group, which consists of a sulfur atom bonded to a carbonyl carbon and a nitrogen atom. This compound features a branched alkyl chain, specifically an ethyl group attached to a butanethioamide backbone, contributing to its unique structural properties. Thioamides are known for their potential reactivity, particularly in nucleophilic substitution reactions and as intermediates in organic synthesis. The presence of the sulfur atom can also impart distinct physical properties, such as lower boiling points compared to their oxygen-containing counterparts. Additionally, 2-ethylbutanethioamide may exhibit specific solubility characteristics, typically being more soluble in organic solvents than in water due to its hydrophobic alkyl chain. Its applications may extend to fields such as pharmaceuticals, agrochemicals, or as a building block in synthetic organic chemistry. However, detailed safety and handling information should be consulted, as thioamides can have varying degrees of toxicity and reactivity.
Formula:C6H13NS
InChI:InChI=1/C6H13NS/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H2,7,8)
SMILES:CCC(CC)C(=N)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.