
CAS 98278-56-9
:3-Piperidinethiol, 1-methyl-
Description:
3-Piperidinethiol, 1-methyl- is an organic compound characterized by a piperidine ring with a thiol (-SH) group and a methyl group attached to the nitrogen atom. Its molecular structure features a six-membered saturated ring containing five carbon atoms and one nitrogen atom, with the thiol group contributing to its reactivity and potential applications in various chemical reactions. This compound is typically a colorless to pale yellow liquid with a distinctive odor, indicative of thiols. It is soluble in polar solvents, which enhances its utility in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The presence of the thiol group allows for nucleophilic reactions, making it a valuable intermediate in the synthesis of other chemical entities. Additionally, 3-Piperidinethiol, 1-methyl- may exhibit biological activity, which warrants careful handling due to potential toxicity. As with many thiols, it may also undergo oxidation to form disulfides, further expanding its reactivity profile in chemical processes.
Formula:C6H13NS
InChI:InChI=1S/C6H13NS/c1-7-4-2-3-6(8)5-7/h6,8H,2-5H2,1H3
InChI key:InChIKey=XSNHICJZIUNEOS-UHFFFAOYSA-N
SMILES:SC1CN(C)CCC1
Synonyms:- 1-Methylpiperidine-3-thiol
- 1-Methyl-piperidine-3-thiol
- 3-Piperidinethiol, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.