CAS 98279-11-9

5,7-Dichloro-2(3H)-benzoxazolethione

Description:

5,7-Dichloro-2(3H)-benzoxazolethione is a chemical compound characterized by its unique structure, which includes a benzoxazole ring substituted with two chlorine atoms and a thione functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of chlorine atoms can influence its reactivity and solubility, often enhancing its lipophilicity. As a thione, it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The compound is of interest in fields such as medicinal chemistry and materials science, where its derivatives may be explored for applications in pharmaceuticals or as intermediates in organic synthesis. Safety data and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 5,7-Dichloro-2(3H)-benzoxazolethione represents a versatile compound with significant implications in research and industry.

Formula: C₇H₃Cl₂NOS

InChI: InChI=1S/C7H3Cl2NOS/c8-3-1-4(9)6-5(2-3)10-7(12)11-6/h1-2H,(H,10,12)

InChI key: InChIKey=MSZMZTZSFPXXAC-UHFFFAOYSA-N

SMILES: ClC1=C2C(NC(=S)O2)=CC(Cl)=C1

Synonyms:

• 2(3H)-Benzoxazolethione, 5,7-dichloro-
• 2-Benzoxazolethiol, 5,7-dichloro-
• 5,7-Dichloro-2(3H)-benzoxazolethione

5,7-Dichlorobenzo[d]oxazole-2-thiol

CAS: 98279-11-9

5,7-Dichlorobenzo[d]oxazole-2-thiol

Purity: 98%

Molecular weight: 220.08g/mol

Ref: 54-OR1032359

5,7-Dichlorobenzo[d]oxazole-2-thiol

CAS: 98279-11-9

Purity: 98%

Molecular weight: 218.93

Ref: 10-F552893

5,7-Dichloro-1,3-benzoxazole-2-thiol

CAS: 98279-11-9

Versatile small molecule scaffold

Formula: C₇H₃Cl₂NOS

Purity: Min. 95%

Molecular weight: 220.07 g/mol

Ref: 3D-YDA27911