CAS 98279-30-2

N-ethyl-N,N'-dimethylethane-1,2-diamine

Description:

N-ethyl-N,N'-dimethylethane-1,2-diamine, with the CAS number 98279-30-2, is an organic compound characterized by its amine functional groups. It features a central ethane backbone with two amine groups, which contribute to its basicity and nucleophilicity. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a distinct amine odor. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of both ethyl and dimethyl groups enhances its steric properties, influencing its reactivity and interaction with other chemical species. N-ethyl-N,N'-dimethylethane-1,2-diamine is often used in the synthesis of various chemical intermediates, surfactants, and as a curing agent in epoxy resins. Due to its amine nature, it can participate in hydrogen bonding, which affects its physical properties such as boiling point and viscosity. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.

Formula: C₆H₁₆N₂

InChI: InChI=1/C6H16N2/c1-4-8(3)6-5-7-2/h7H,4-6H2,1-3H3

SMILES: CCN(C)CCNC

N-ethyl-N,N’-dimethyl-1,2-ethanediamine

CAS: 98279-30-2

Formula: C₆H₁₆N₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 116.208

Ref: 10-F310680