CymitQuimica logo

CAS 98279-88-0

:

Glycine, N-(5-nitro-2-pyridyl)-

Description:
Glycine, N-(5-nitro-2-pyridyl)-, is a chemical compound characterized by its structure, which includes a glycine moiety linked to a 5-nitro-2-pyridyl group. This compound is typically classified as an amino acid derivative due to the presence of the glycine backbone, which is the simplest amino acid. The nitro group and pyridine ring contribute to its unique chemical properties, including potential biological activity and solubility characteristics. It is often studied for its applications in pharmaceuticals and agrochemicals, particularly for its role in various biochemical pathways. The presence of the nitro group may impart specific reactivity, making it a candidate for further chemical modifications or as a precursor in synthetic chemistry. Additionally, the compound's molecular interactions can be influenced by the pyridine ring, affecting its behavior in biological systems. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with nitro compounds.
Formula:C7H7N3O4
InChI:InChI=1S/C7H7N3O4/c11-7(12)4-9-6-2-1-5(3-8-6)10(13)14/h1-3H,4H2,(H,8,9)(H,11,12)
InChI key:InChIKey=UTQIRUGUSNPZPE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=CC(NCC(O)=O)=NC1
Synonyms:
  • 2-[(5-Nitropyridin-2-yl)amino]acetic acid
  • Glycine, N-(5-nitro-2-pyridyl)-
  • N-(5-nitro-[2]pyridyl)-glycine
  • Glycine, N-(5-nitro-2-pyridyl)- (6CI)
  • (5-Nitropyridin-2-yl)glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.