CymitQuimica logo

CAS 98288-02-9

:

2-[[(3-Bromophenyl)methyl]thio]acetamide

Description:
2-[[(3-Bromophenyl)methyl]thio]acetamide, with the CAS number 98288-02-9, is an organic compound characterized by the presence of a thioether functional group and an amide linkage. This compound features a brominated phenyl group, which contributes to its potential reactivity and biological activity. The thioether moiety, derived from the methylthio group, enhances the compound's solubility in organic solvents and may influence its interaction with biological targets. The amide functional group is known for its ability to form hydrogen bonds, which can affect the compound's stability and reactivity. Additionally, the presence of the bromine atom can impart unique electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for precise values.
Formula:C9H10BrNOS
InChI:InChI=1S/C9H10BrNOS/c10-8-3-1-2-7(4-8)5-13-6-9(11)12/h1-4H,5-6H2,(H2,11,12)
InChI key:InChIKey=LYYIDLLIXBYCTI-UHFFFAOYSA-N
SMILES:C(SCC(N)=O)C1=CC(Br)=CC=C1
Synonyms:
  • 2-[[(3-Bromophenyl)methyl]sulfanyl]acetamide
  • 2-[[(3-Bromophenyl)methyl]thio]acetamide
  • Acetamide, 2-[[(3-bromophenyl)methyl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.