CAS 98300-80-2
:CMP-NeuGc
Description:
CMP-NeuGc, or Cytidine Monophosphate N-Glycolylneuraminic Acid, is a nucleotide sugar derivative that plays a significant role in cellular processes, particularly in the biosynthesis of glycoproteins and glycolipids. It is characterized by the presence of a glycolyl group attached to the neuraminic acid moiety, which distinguishes it from its counterpart, CMP-NeuAc (Cytidine Monophosphate N-Acetylneuraminic Acid). CMP-NeuGc is involved in various biological functions, including cell signaling and immune responses, and is known to be incorporated into glycoconjugates in certain mammalian cells. Its structure allows it to participate in sialylation processes, which are crucial for the proper functioning of glycoproteins. CMP-NeuGc is of particular interest in research related to cancer biology and immunology, as it can influence cell interactions and immune evasion mechanisms. However, it is important to note that humans do not naturally synthesize NeuGc due to a genetic mutation, making its study relevant for understanding evolutionary biology and potential therapeutic applications.
Formula:C20H31N4O17P
InChI:InChI=1S/C20H31N4O17P/c21-10-1-2-24(19(35)22-10)17-15(32)14(31)9(39-17)6-38-42(36,37)41-20(18(33)34)3-7(27)12(23-11(29)5-26)16(40-20)13(30)8(28)4-25/h1-2,7-9,12-17,25-28,30-32H,3-6H2,(H,23,29)(H,33,34)(H,36,37)(H2,21,22,35)/t7-,8+,9+,12+,13+,14+,15+,16+,17+,20+/m0/s1
InChI key:InChIKey=HOEWKBQADMRCLO-UIUGZIMDSA-N
SMILES:O(P(OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N2C(=O)N=C(N)C=C2)(=O)O)[C@]3(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(CO)=O)[C@@H](O)C3)[H]
Synonyms:- D-glycero-β-D-galacto-2-Nonulopyranosonic acid, 3,5-dideoxy-5-[(hydroxyacetyl)amino]-, 2-(hydrogen 5′-cytidylate)
- CMP-Neu5Gc.2Na
- β-Neuraminic acid, N-(hydroxyacetyl)-, 2-(hydrogen 5′-cytidylate)
- β-Neuraminic acid, N-(2-hydroxyacetyl)-, 2-(hydrogen 5′-cytidylate)
- CMP-NeuGc
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CMP-Neu5Gc sodium salt
CAS:Please enquire for more information about CMP-Neu5Gc sodium salt including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C20H29N4Na2O17PMolecular weight:674.41 g/mol
