
CAS 98305-82-9
:2-Amino-6-[4-(phenylmethoxy)phenyl]-4(3H)-pyrimidinone
Description:
2-Amino-6-[4-(phenylmethoxy)phenyl]-4(3H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features an amino group and a phenylmethoxy substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar organic solvents due to the presence of the amino and methoxy groups. The phenylmethoxy group can enhance lipophilicity, influencing its interaction with biological systems. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often explored for their biological activities, including anti-cancer and anti-inflammatory properties. The compound's CAS number, 98305-82-9, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the unique combination of functional groups in 2-Amino-6-[4-(phenylmethoxy)phenyl]-4(3H)-pyrimidinone contributes to its potential utility in various chemical and biological applications.
Formula:C17H15N3O2
InChI:InChI=1S/C17H15N3O2/c18-17-19-15(10-16(21)20-17)13-6-8-14(9-7-13)22-11-12-4-2-1-3-5-12/h1-10H,11H2,(H3,18,19,20,21)
InChI key:InChIKey=LHHJIIASJAPIRE-UHFFFAOYSA-N
SMILES:O=C1C=C(C2=CC=C(OCC3=CC=CC=C3)C=C2)NC(N)=N1
Synonyms:- 2-Amino-6-[4-(phenylmethoxy)phenyl]-4(3H)-pyrimidinone
- 4(3H)-Pyrimidinone, 2-amino-6-[4-(phenylmethoxy)phenyl]-
- 2-Amino-6-(4-benzyloxyphenyl)-3H-pyrimidin-4-one
- 4(1H)-Pyrimidinone, 2-amino-6-[4-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
