CAS 98318-77-5

1-(naphthalen-2-ylmethyl)-1H-imidazole

Description:

1-(Naphthalen-2-ylmethyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a naphthylmethyl group, where a naphthalene moiety is attached to the imidazole via a methylene bridge. The presence of the naphthalene ring contributes to its aromatic properties, potentially influencing its electronic characteristics and reactivity. The imidazole part of the molecule is known for its basicity and ability to participate in hydrogen bonding, making it relevant in various biological and chemical contexts. This compound may exhibit interesting pharmacological properties, as imidazole derivatives are often explored for their roles in medicinal chemistry. Additionally, its structural features suggest potential applications in materials science or as a ligand in coordination chemistry. Overall, 1-(naphthalen-2-ylmethyl)-1H-imidazole is a compound of interest due to its unique structural characteristics and potential utility in various chemical applications.

Formula: C₁₄H₁₂N₂

InChI: InChI=1/C14H12N2/c1-2-4-14-9-12(5-6-13(14)3-1)10-16-8-7-15-11-16/h1-9,11H,10H2

Synonyms:

• 1H-imidazole, 1-(2-naphthalenylmethyl)-
• 1-(2-Naphthylmethyl)-1H-imidazole

1-[(Naphthalen-2-yl)methyl]-1H-imidazole

CAS: 98318-77-5

Versatile small molecule scaffold

Formula: C₁₄H₁₂N₂

Purity: Min. 95%

Molecular weight: 208.26 g/mol

Ref: 3D-YDA31877