
CAS 98334-41-9
:2-Propyl-4(3H)-pyrimidinone
Description:
2-Propyl-4(3H)-pyrimidinone, identified by its CAS number 98334-41-9, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a propyl group and a carbonyl group. This compound typically exhibits characteristics common to pyrimidinones, including a polar nature due to the presence of the carbonyl group, which can participate in hydrogen bonding. It is generally soluble in polar solvents, such as water and alcohols, while exhibiting limited solubility in non-polar solvents. The compound may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. Its structure allows for potential interactions with biological macromolecules, which can influence its pharmacological properties. Additionally, 2-Propyl-4(3H)-pyrimidinone may undergo various chemical reactions typical of pyrimidine derivatives, including nucleophilic substitutions and condensation reactions, which can be leveraged in synthetic organic chemistry. Overall, its unique structure and properties make it a valuable compound in both research and industrial applications.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-2-3-6-8-5-4-7(10)9-6/h4-5H,2-3H2,1H3,(H,8,9,10)
InChI key:InChIKey=USBRWLQHTGAEIN-UHFFFAOYSA-N
SMILES:C(CC)C=1NC(=O)C=CN1
Synonyms:- 4(3H)-Pyrimidinone, 2-propyl-
- 4(1H)-Pyrimidinone, 2-propyl-
- 2-Propyl-3,4-dihydropyrimidin-4-one
- 2-Propyl-4(3H)-pyrimidinone
- 2-Propylpyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.