CAS 98348-21-1
:N-(1-methyl-2-piperidin-1-ylethyl)-N-phenylpropanamide hydrochloride
Description:
N-(1-methyl-2-piperidin-1-ylethyl)-N-phenylpropanamide hydrochloride, with the CAS number 98348-21-1, is a chemical compound that belongs to the class of amides. It features a piperidine ring, which contributes to its potential biological activity, particularly in pharmacological applications. The presence of the phenyl group suggests that it may exhibit aromatic characteristics, influencing its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical contexts. The compound may exhibit properties such as analgesic or psychoactive effects, given its structural features, but specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structure positions it as a candidate for research in medicinal chemistry and drug development.
Formula:C17H27ClN2O
InChI:InChI=1/C17H26N2O.ClH/c1-3-17(20)19(16-10-6-4-7-11-16)15(2)14-18-12-8-5-9-13-18;/h4,6-7,10-11,15H,3,5,8-9,12-14H2,1-2H3;1H
SMILES:CCC(=O)N(C(C)CN1CCCCC1)c1ccccc1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.