CAS 98395-62-1

2-(4-nitrophenoxy)ethanamine hydrochloride

Description:

2-(4-Nitrophenoxy)ethanamine hydrochloride is an organic compound characterized by its amine and ether functional groups. It features a 4-nitrophenoxy group attached to an ethanamine backbone, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and biochemistry. The presence of the nitro group enhances its electrophilic properties, making it useful in synthetic organic chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in aqueous solutions. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its molecular structure allows for interactions with biological targets, which could be explored for therapeutic applications. Safety data should be consulted for handling and storage, as compounds with nitro groups can pose specific hazards. Overall, 2-(4-nitrophenoxy)ethanamine hydrochloride is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₁₁ClN₂O₃

InChI: InChI=1/C8H10N2O3.ClH/c9-5-6-13-8-3-1-7(2-4-8)10(11)12;/h1-4H,5-6,9H2;1H

SMILES: c1cc(ccc1N(=O)=O)OCCN.Cl

4-(2-Aminoethoxy)-1-nitrobenzene, HCl

CAS: 98395-62-1

Formula: C₈H₁₁ClN₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.6375

Ref: IN-DA00IK2P

4-(2-Aminoethoxy)-1-nitrobenzene hydrochloride

CAS: 98395-62-1

4-(2-Aminoethoxy)-1-nitrobenzene hydrochloride

Formula: C₈H₁₀N₂O₃·ClH

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 218.64g/mol

Ref: 54-OR11412

2-(4-NITROPHENOXY)ETHYLAMINE HYDROCHLORIDE

CAS: 98395-62-1

Purity: 98%

Molecular weight: 218.6399994

Ref: 10-F832294

4-(2-Aminoethoxy)-1-nitrobenzene HCl

CAS: 98395-62-1

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₃·HCl

Purity: Min. 95%

Molecular weight: 218.64 g/mol

Ref: 3D-YDA39562