CymitQuimica logo

CAS 98395-62-1

:

2-(4-nitrophenoxy)ethanamine hydrochloride

Description:
2-(4-Nitrophenoxy)ethanamine hydrochloride is an organic compound characterized by its amine and ether functional groups. It features a 4-nitrophenoxy group attached to an ethanamine backbone, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and biochemistry. The presence of the nitro group enhances its electrophilic properties, making it useful in synthetic organic chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in aqueous solutions. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its molecular structure allows for interactions with biological targets, which could be explored for therapeutic applications. Safety data should be consulted for handling and storage, as compounds with nitro groups can pose specific hazards. Overall, 2-(4-nitrophenoxy)ethanamine hydrochloride is a versatile compound with significant implications in chemical research and development.
Formula:C8H11ClN2O3
InChI:InChI=1/C8H10N2O3.ClH/c9-5-6-13-8-3-1-7(2-4-8)10(11)12;/h1-4H,5-6,9H2;1H
InChI key:UIMOMIHYFRGWIG-UHFFFAOYSA-N
SMILES:c1cc(ccc1N(=O)=O)OCCN.Cl
Found 5 products.