
CAS 98395-65-4
:Ethanamine, 2-(2-nitrophenoxy)-, hydrochloride (1:1)
Description:
Ethanamine, 2-(2-nitrophenoxy)-, hydrochloride (1:1), also known by its CAS number 98395-65-4, is a chemical compound characterized by the presence of an ethanamine backbone substituted with a 2-nitrophenoxy group. This compound typically appears as a crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility and stability. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity, making it potentially useful in various chemical syntheses and applications. The ethanamine portion contributes to its basicity, allowing it to participate in reactions typical of amines, such as nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted, as nitro compounds can sometimes be hazardous, and appropriate handling procedures should be followed. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C8H10N2O3·ClH
InChI:InChI=1S/C8H10N2O3.ClH/c9-5-6-13-8-4-2-1-3-7(8)10(11)12;/h1-4H,5-6,9H2;1H
InChI key:InChIKey=RXKSKQFXCBODPH-UHFFFAOYSA-N
SMILES:O(CCN)C1=C(N(=O)=O)C=CC=C1.Cl
Synonyms:- Ethanamine, 2-(2-nitrophenoxy)-, monohydrochloride
- 2-(2-Nitrophenoxy)ethylamine Hydrochloride
- Ethanamine, 2-(2-nitrophenoxy)-, hydrochloride (1:1)
- 2-(2-Nitrophenoxy)ethylamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
