CAS 98410-68-5
:3,5-dimethoxynaphthalene-2-carboxylic acid
Description:
3,5-Dimethoxynaphthalene-2-carboxylic acid is an organic compound characterized by its naphthalene backbone, which is substituted at the 2-position with a carboxylic acid group and at the 3 and 5 positions with methoxy groups. This structure contributes to its unique chemical properties, including its potential as a building block in organic synthesis and its applications in pharmaceuticals and materials science. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The methoxy groups enhance the compound's solubility in organic solvents and can influence its electronic properties, making it a candidate for studies in electronic materials. Additionally, the compound may exhibit interesting biological activities, although specific biological data would require further investigation. Overall, 3,5-dimethoxynaphthalene-2-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C13H12O4
InChI:InChI=1/C13H12O4/c1-16-11-5-3-4-8-6-10(13(14)15)12(17-2)7-9(8)11/h3-7H,1-2H3,(H,14,15)
SMILES:COc1cccc2cc(c(cc12)OC)C(=O)O
Synonyms:- 2-Naphthalenecarboxylic Acid, 3,5-Dimethoxy-
- 3,5-Dimethoxy-2-naphthoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
