CAS 98414-56-3
:1,3-Bis(1H-1,2,4-triazol-1-yl)-2-propanone
Description:
1,3-Bis(1H-1,2,4-triazol-1-yl)-2-propanone, with the CAS number 98414-56-3, is a chemical compound characterized by its unique structure that includes two triazole rings attached to a propanone moiety. This compound is known for its potential applications in various fields, including pharmaceuticals and agricultural chemistry, due to the biological activity associated with triazole derivatives. It typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. The presence of the triazole rings contributes to its ability to form hydrogen bonds, which can enhance its interactions with biological targets. Additionally, this compound may exhibit antifungal and antimicrobial properties, making it of interest in the development of new therapeutic agents. Its synthesis often involves multi-step organic reactions, highlighting the importance of careful handling and characterization to ensure purity and efficacy in applications. Overall, 1,3-Bis(1H-1,2,4-triazol-1-yl)-2-propanone represents a significant class of compounds in medicinal chemistry.
Formula:C7H8N6O
InChI:InChI=1S/C7H8N6O/c14-7(1-12-5-8-3-10-12)2-13-6-9-4-11-13/h3-6H,1-2H2
InChI key:InChIKey=KQQIIJSWEPRYPF-UHFFFAOYSA-N
SMILES:C(C(CN1C=NC=N1)=O)N2C=NC=N2
Synonyms:- 1,3-Bis(1,2,4-triazol-1-yl)propan-2-one
- 1,3-Bis(1H-1,2,4-triazol-1-yl)-2-propanone
- 2-Propanone, 1,3-bis(1H-1,2,4-triazol-1-yl)-
- 1,3-Di(1H-1,2,4-triazol-1-yl)propan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

