CAS 98437-23-1
:Benzo[b]thiophene-2-boronic acid
Description:
Benzo[b]thiophene-2-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzo[b]thiophene ring system. This compound typically exhibits a planar structure due to the aromatic nature of the benzo[b]thiophene moiety, which contributes to its stability and potential for π-π stacking interactions. The boronic acid group (-B(OH)2) is known for its reactivity, particularly in forming covalent bonds with diols, making it useful in various organic synthesis applications, including Suzuki coupling reactions. Benzo[b]thiophene-2-boronic acid is also of interest in medicinal chemistry due to its potential biological activity, as derivatives of boronic acids have been explored for their therapeutic properties. The compound is generally soluble in polar organic solvents, and its reactivity can be influenced by the presence of substituents on the aromatic ring. Overall, benzo[b]thiophene-2-boronic acid serves as a valuable building block in the synthesis of complex organic molecules and materials.
Formula:C8H7BO2S
InChI:InChI=1/C8H7BO2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H
SMILES:c1ccc2c(c1)cc(B(O)O)s2
Synonyms:- 1-Benzothiophen-2-ylboronic acid
- Benzo(B)Thiophene-2-Ylboronic Acid
- Boronic acid, B-benzo[b]thien-2-yl-
- 2-Benzothienylboronic acid
- 1-Benzothien-2-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzo[b]thiophene-2-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H7BO2SPurity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:178.01Benzo[b]thiophene-2-boronic acid, 97%
CAS:Benzo[b]thiophene-2-boronic acid is used in the synthesis of phosphorescent sensor for quantification of copper(II) ion, UV promoted phenanthridine syntheses, Preparation of CYP11B1 inhibitors for treatment of cortisol dependent diseases, PDE4 inhibitors, Suzuki-Miyaura cross-coupling reactions. Thi
Formula:C8H7BO2SPurity:97%Color and Shape:White to cream, PowderMolecular weight:178.01Benzo[b]thiophen-2-ylboronic acid
CAS:Formula:C8H7BO2SPurity:98%Color and Shape:SolidMolecular weight:178.0160Ref: IN-DA003GKS
1g21.00€5g31.00€10g56.00€1kgTo inquire25g88.00€50g128.00€100g171.00€250g531.00€500gTo inquireBenzo(b)thiophene-2-boronic acid
CAS:Formula:C8H7BO2SPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:178.02Benzo[b]thiophene-2-boronic acid
CAS:Benzo[b]thiophene-2-boronic acidFormula:C8H7BO2SPurity:≥95%Color and Shape: white to off-white to light brown solidMolecular weight:178.02g/molBenzo[b]thiophene-2-boronic acid
CAS:Formula:C8H7BO2SPurity:97%Color and Shape:Solid, Crystalline PowderMolecular weight:178.01





