CAS 98437-24-2
:Benzo(b)furan-2-boronic acid
Description:
Benzo(b)furan-2-boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a benzo(b)furan moiety. This compound features a fused ring system that combines a benzene ring with a furan ring, contributing to its aromatic properties and potential reactivity. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Benzo(b)furan-2-boronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is valuable for constructing complex organic molecules. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and conditions, and it is typically handled with care due to the reactivity of the boronic acid group. Overall, benzo(b)furan-2-boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H7BO3
InChI:InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H
SMILES:c1ccc2c(c1)cc(B(O)O)o2
Synonyms:- Benzofuran-2-boronic acid
- 1-Benzofuran-2-ylboronic acid
- Benzofuran-2-ylboronic acid
- Benzo[b]furan-2-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzofuran-2-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H7BO3Purity:97.0 to 113.0 %Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:161.95Benzo[b]furan-2-boronic acid, 98%
CAS:It is used in the facile preparation of highly-functionalized, nitrogen-bearing diarylmethanes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prod
Formula:C8H7BO3Purity:98%Color and Shape:Powder, Pale yellow to pale brownMolecular weight:161.95Benzofuran-2-boronic acid
CAS:Formula:C8H7BO3Purity:98%Color and Shape:SolidMolecular weight:161.9504Ref: IN-DA003O24
1g25.00€5g43.00€10g62.00€1kgTo inquire25g122.00€50gTo inquire100g270.00€250g545.00€500gTo inquireBenzo[b]furan-2-boronic acid
CAS:Benzo[b]furan-2-boronic acidFormula:C8H7BO3Purity:98%Color and Shape: off white solidMolecular weight:161.95g/molBenzo[b]furan-2-boronic acid
CAS:Formula:C8H7BO3Purity:98%Color and Shape:SolidMolecular weight:161.95Benzo[b]furan-2-boronic acid
CAS:Benzo[b]furan-2-boronic acid is a potent matrix metalloproteinase inhibitor that can be used in the treatment of cancer. It is synthesized from 2-aminobenzofuran by using a Suzuki coupling reaction with boronic acid. Benzo[b]furan-2-boronic acid has been shown to inhibit MMP-1, MMP-13, and MMP-14. This compound also inhibits the activity of other proteases such as cathepsin G, elastase, and chymase. The compound has been shown to be cytotoxic against human breast cancer cells and colon cancer cells. In addition, this compound is fluorescent and its fluorescence has been shown to increase when it binds to cancer cells.Formula:C8H7BO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:161.95 g/mol






