CAS 98437-41-3
:5-bromo-2-hydroxy-4-methoxybenzoic acid
Description:
5-Bromo-2-hydroxy-4-methoxybenzoic acid, with the CAS number 98437-41-3, is an aromatic compound characterized by the presence of a bromine atom, a hydroxyl group, and a methoxy group attached to a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The bromine substituent enhances its electrophilic character, making it useful in further synthetic applications, while the hydroxyl and methoxy groups can influence its solubility and polarity. Typically, such compounds exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of other functional groups and the specific reaction conditions. Additionally, the presence of these substituents can affect the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, 5-bromo-2-hydroxy-4-methoxybenzoic acid is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C8H7BrO4
InChI:InChI=1/C8H7BrO4/c1-13-7-3-6(10)4(8(11)12)2-5(7)9/h2-3,10H,1H3,(H,11,12)
SMILES:COc1cc(c(cc1Br)C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-BROMO-2-HYDROXY-4-METHOXYBENZOIC ACID
CAS:Formula:C8H7BrO4Purity:95%Color and Shape:SolidMolecular weight:247.04285-Bromo-2-hydroxy-4-methoxybenzoic acid
CAS:5-Bromo-2-hydroxy-4-methoxybenzoic acidPurity:95%Molecular weight:247.04g/mol2-Bromo-5-hydroxy-4-methoxybenzoic acid
CAS:2-Bromo-5-hydroxy-4-methoxybenzoic acid is a versatile compound used in various applications. It can be used as a building block for polymers and organic synthesis. This compound is soluble in dimethyl sulfoxide (DMSO) and can be used as an intermediate in the synthesis of l-tyrosine, an important amino acid. Additionally, 2-Bromo-5-hydroxy-4-methoxybenzoic acid has antiviral properties and has been studied for its potential to inhibit the 5-HT2C receptor. It can also be used in ozonolysis reactions and as an activated carboxylate for amide formation. This research chemical is available for purchase and is suitable for various laboratory applications.Formula:C8H7BrO4Purity:Min. 95%Molecular weight:247.04 g/mol



