
CAS 98440-51-8
:1-[5-(4-Morpholinyl)-2-nitrophenyl]ethanone
Description:
1-[5-(4-Morpholinyl)-2-nitrophenyl]ethanone, with the CAS number 98440-51-8, is an organic compound characterized by its complex structure, which includes a morpholine ring and a nitrophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the nitro group suggests that it may participate in electrophilic aromatic substitution reactions, while the morpholine moiety can influence its basicity and nucleophilicity. Additionally, the ethanone functional group indicates that it may undergo typical ketone reactions, such as nucleophilic addition. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with morpholine derivatives. Safety and handling precautions should be observed, as compounds containing nitro groups can be sensitive and may pose health risks. Overall, this compound's unique characteristics make it of interest in various chemical research and application fields.
Formula:C12H14N2O4
InChI:InChI=1S/C12H14N2O4/c1-9(15)11-8-10(2-3-12(11)14(16)17)13-4-6-18-7-5-13/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=QDBHDRNQTORPRV-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=C(C=CC1N(=O)=O)N2CCOCC2
Synonyms:- Ethanone, 1-[5-(4-morpholinyl)-2-nitrophenyl]-
- 2′-Nitro-5′-(morpholin-4-yl)acetophenone
- 1-[5-(4-Morpholinyl)-2-nitrophenyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.