CymitQuimica logo

CAS 98448-79-4

:

N-(Azetidin-3-yl)-2,2,2-trifluoroacetamide

Description:
N-(Azetidin-3-yl)-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes an azetidine ring and a trifluoroacetamide functional group. The azetidine moiety contributes to its cyclic nature, while the trifluoroacetamide group imparts significant polarity and potential reactivity due to the presence of three fluorine atoms, which enhance the compound's electronegativity and influence its interactions with other molecules. This compound is likely to exhibit properties typical of amides, such as hydrogen bonding capabilities, which can affect its solubility and boiling point. The trifluoromethyl group can also enhance the compound's stability and lipophilicity, making it of interest in medicinal chemistry and material science. Additionally, the presence of the azetidine ring may confer specific biological activities, making it a candidate for further research in pharmacology. Overall, N-(Azetidin-3-yl)-2,2,2-trifluoroacetamide represents a versatile structure with potential applications in various chemical and pharmaceutical fields.
Formula:C5H7F3N2O
InChI:InChI=1/C5H7F3N2O/c6-5(7,8)4(11)10-3-1-9-2-3/h3,9H,1-2H2,(H,10,11)
SMILES:C1C(CN1)N=C(C(F)(F)F)O
Synonyms:
  • acetamide, N-3-azetidinyl-2,2,2-trifluoro-
  • N-(Azetidin-3-yl)-2,2,2-trifluoroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.