
CAS 98454-43-4
:rel-(1R,2R)-2-(Phenylmethoxy)cyclohexanamine
Description:
Rel-(1R,2R)-2-(Phenylmethoxy)cyclohexanamine, with the CAS number 98454-43-4, is a chiral amine characterized by its cyclohexane ring structure substituted with a phenylmethoxy group and an amine functional group. This compound exhibits stereochemistry, specifically in the (1R,2R) configuration, which influences its biological activity and interactions. The presence of the phenylmethoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. As a chiral molecule, it may exhibit different pharmacological properties depending on its stereoisomeric form, making it of interest in medicinal chemistry and drug development. The amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, the unique structural features of rel-(1R,2R)-2-(Phenylmethoxy)cyclohexanamine contribute to its potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H19NO
InChI:InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/s2
InChI key:InChIKey=NTHNRYLIXJZHRZ-NVHKGDCHNA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](N)CCCC2
Synonyms:- Cyclohexanamine, 2-(phenylmethoxy)-, (1R,2R)-rel-
- trans-2-Benzyloxycyclohexanamine
- Cyclohexanamine, 2-(phenylmethoxy)-, trans-
- rel-(1R,2R)-2-(Phenylmethoxy)cyclohexanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.