CAS 98454-45-6
:N-(4-benzyloxycyclohexyl)-5-chloro-pentanamide
Description:
N-(4-benzyloxycyclohexyl)-5-chloro-pentanamide, identified by its CAS number 98454-45-6, is a chemical compound that features a complex structure characterized by the presence of a cyclohexyl group, a benzyloxy substituent, and a chloro group attached to a pentanamide backbone. This compound is likely to exhibit properties typical of amides, such as moderate polarity due to the amide functional group, which can engage in hydrogen bonding. The presence of the chloro substituent may influence its reactivity and solubility in various solvents. Additionally, the benzyloxy group can enhance lipophilicity, potentially affecting the compound's biological activity and pharmacokinetics. The structural features suggest that it may have applications in medicinal chemistry, possibly as a pharmaceutical agent or a precursor in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.
Formula:C18H26ClNO2
InChI:InChI=1/C18H26ClNO2/c19-13-5-4-8-18(21)20-16-9-11-17(12-10-16)22-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2,(H,20,21)/t16?,17-
SMILES:c1ccc(cc1)CO[C@H]1CCC(CC1)N=C(CCCCCl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]pentanamide
CAS:Controlled ProductApplications Intermediate of OPC-13013, a metabolite of Cilostazol.
References Nishi, T., et al.: Chem. Pharm. Bull., 33, 1140 (1985),Formula:C18H26ClNO2Color and Shape:NeatMolecular weight:323.86Trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]pentanamide
CAS:Formula:C18H26ClNO2Molecular weight:323.86

