CAS 98462-03-4
:8(S)-Hydroxyeicosatetraenoic acid
Description:
8(S)-Hydroxyeicosatetraenoic acid (8(S)-HETE) is a bioactive lipid derived from arachidonic acid, a polyunsaturated fatty acid that plays a crucial role in various physiological processes. This compound is characterized by its hydroxyl group at the 8th carbon position and is classified as a hydroxy fatty acid. 8(S)-HETE is known to be involved in several biological activities, including modulation of inflammation, regulation of vascular tone, and influence on cell signaling pathways. It acts as a signaling molecule, participating in the synthesis of other eicosanoids and influencing processes such as platelet aggregation and smooth muscle contraction. The stereochemistry of the hydroxyl group is significant, as it can affect the compound's biological activity and interactions with receptors. 8(S)-HETE is also studied for its potential implications in various diseases, including cardiovascular disorders and cancer, making it a subject of interest in pharmacological research. Its presence in biological systems underscores the complexity of lipid signaling and the importance of fatty acid derivatives in health and disease.
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+/t19-/m1/s1
InChI key:InChIKey=NLUNAYAEIJYXRB-VYOQERLCSA-N
SMILES:[C@H](C/C=C\CCCC(O)=O)(/C=C/C=C\C/C=C\CCCCC)O
Synonyms:- (5Z,8S,9E,11Z,14Z)-8-Hydroxy-5,9,11,14-eicosatetraenoic acid
- (5Z,8S,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid
- 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, (5Z,8S,9E,11Z,14Z)-
- 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, [S-(E,Z,Z,Z)]-
- 8(S)-Hydroxyeicosatetraenoic acid
- 8S-Hete
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8(S)-hydroxy-5(Z),9(E),11(Z),14(Z)-eicosatetraenoic acid
CAS:Formula:C20H32O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:320.478-Hydroxyeicosatetraenoic acid
CAS:8-Hydroxyeicosatetraenoic acid is a hydroxylated metabolite, which is predominantly derived from the oxygenation of arachidonic acid. This compound acts primarily as a key intermediate in the biosynthesis of eicosanoids, which are signaling molecules associated with various physiological functions. The mode of action of 8-Hydroxyeicosatetraenoic acid involves its interaction with specific receptors and enzymes, influencing pathways that regulate inflammation, immune response, and cellular growth.Formula:C20H32O3Purity:Min. 95%Molecular weight:320.5 g/mol8(S)-HETE
CAS:8(S)-HETE activates mouse keratinocyte PKC (IC50: 100 μM) and PPARα (>0.3 μM); identified by chiral HPLC in murine skin.Formula:C20H32O3Color and Shape:SolidMolecular weight:320.47



