CAS 98462-03-4

8(S)-Hydroxyeicosatetraenoic acid

Description:

8(S)-Hydroxyeicosatetraenoic acid (8(S)-HETE) is a bioactive lipid derived from arachidonic acid, a polyunsaturated fatty acid that plays a crucial role in various physiological processes. This compound is characterized by its hydroxyl group at the 8th carbon position and is classified as a hydroxy fatty acid. 8(S)-HETE is known to be involved in several biological activities, including modulation of inflammation, regulation of vascular tone, and influence on cell signaling pathways. It acts as a signaling molecule, participating in the synthesis of other eicosanoids and influencing processes such as platelet aggregation and smooth muscle contraction. The stereochemistry of the hydroxyl group is significant, as it can affect the compound's biological activity and interactions with receptors. 8(S)-HETE is also studied for its potential implications in various diseases, including cardiovascular disorders and cancer, making it a subject of interest in pharmacological research. Its presence in biological systems underscores the complexity of lipid signaling and the importance of fatty acid derivatives in health and disease.

Formula: C₂₀H₃₂O₃

InChI: InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+/t19-/m1/s1

InChI key: InChIKey=NLUNAYAEIJYXRB-VYOQERLCSA-N

SMILES: [C@H](C/C=C\CCCC(O)=O)(/C=C/C=C\C/C=C\CCCCC)O

Synonyms:

• (5Z,8S,9E,11Z,14Z)-8-Hydroxy-5,9,11,14-eicosatetraenoic acid
• (5Z,8S,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid
• 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, (5Z,8S,9E,11Z,14Z)-
• 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, [S-(E,Z,Z,Z)]-
• 8(S)-Hydroxyeicosatetraenoic acid
• 8S-Hete

8(S)-Hydroxy-(5Z,9E,11Z,14Z)-eicosatetraenoic acid

CAS: 98462-03-4

Formula: C₂₀H₃₂O₃

Molecular weight: 320.47

Ref: 7W-GL8509

8(S)-hydroxy-5(Z),9(E),11(Z),14(Z)-eicosatetraenoic acid

CAS: 98462-03-4

Formula: C20H32O3

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 320.47

Ref: 48-14-2083

8-Hydroxyeicosatetraenoic acid

CAS: 98462-03-4

8-Hydroxyeicosatetraenoic acid is a hydroxylated metabolite, which is predominantly derived from the oxygenation of arachidonic acid. This compound acts primarily as a key intermediate in the biosynthesis of eicosanoids, which are signaling molecules associated with various physiological functions. The mode of action of 8-Hydroxyeicosatetraenoic acid involves its interaction with specific receptors and enzymes, influencing pathways that regulate inflammation, immune response, and cellular growth.

Formula: C₂₀H₃₂O₃

Purity: Min. 95%

Molecular weight: 320.5 g/mol

Ref: 3D-YDA46203

8(S)-HETE

CAS: 98462-03-4

8(S)-HETE activates mouse keratinocyte PKC (IC50: 100 μM) and PPARα (>0.3 μM); identified by chiral HPLC in murine skin.

Formula: C₂₀H₃₂O₃

Color and Shape: Solid

Molecular weight: 320.47

Ref: TM-T37158