CAS 98475-07-1
:Benzoic acid, 2-(bromomethyl)-3-nitro-, methyl ester
Description:
Benzoic acid, 2-(bromomethyl)-3-nitro-, methyl ester, with the CAS number 98475-07-1, is an organic compound characterized by its functional groups and structural features. It contains a benzoic acid moiety, which is a carboxylic acid derivative, and is further modified by the presence of a bromomethyl group and a nitro group at specific positions on the aromatic ring. The methyl ester functional group indicates that the carboxylic acid has been esterified with methanol, enhancing its solubility in organic solvents. This compound typically exhibits moderate polarity due to the presence of both polar (nitro and carboxylate) and nonpolar (aromatic) components. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the reactive bromomethyl and nitro groups. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can be influenced by the presence of these substituents, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H8BrNO4
InChI:InChI=1S/C9H8BrNO4/c1-15-9(12)6-3-2-4-8(11(13)14)7(6)5-10/h2-4H,5H2,1H3
InChI key:InChIKey=FCGIVHSBEKGQMZ-UHFFFAOYSA-N
SMILES:C(Br)C1=C(C(OC)=O)C=CC=C1N(=O)=O
Synonyms:- 2-Bromomethyl-3-Nitrobenzoic Acid Methyl Ester
- 2-Bromomethyl-3-NitrobenzoicAcidMethylEster
- Benzoic acid, 2-(bromomethyl)-3-nitro-, methyl ester
- Methyl 2-bromomethyl-3-nitrobezoate
- methyl 2-(bromomethyl)-3-nitrobenzoate
- Methyl 2-(bromomethyl)-3-nitrobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Methyl 2-(Bromomethyl)-3-nitrobenzoate
CAS:Formula:C9H8BrNO4Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:274.07Methyl 2-(Bromomethyl)-3-nitrobenzoate
CAS:Formula:C9H8BrNO4Purity:95%Color and Shape:SolidMolecular weight:274.0681Ref: IN-DA0035W9
1g22.00€5g30.00€10g40.00€15g51.00€1kg526.00€25g65.00€50g105.00€5kgTo inquire100g110.00€10kgTo inquire500g559.00€Methyl 2-(bromomethyl)-3-nitrobenzoate
CAS:Methyl 2-(bromomethyl)-3-nitrobenzoatePurity:98%Color and Shape:Pale Yellow SolidMolecular weight:274.06811g/molMethyl 2-(bromomethyl)-3-nitrobenzoate
CAS:Formula:C9H8BrNO4Purity:95%Color and Shape:PowderMolecular weight:274.072-(Bromomethyl)-3-nitrobenzoic acid methyl ester
CAS:2-(Bromomethyl)-3-nitrobenzoic acid methyl ester is a synthetic compound that is a byproduct of ammonium nitrate production. It is prepared by the reaction of 2-methyl-3-nitrobenzoic acid with bromine and methanol in the presence of palladium catalyst. The product is used to synthesize l-glutamic acid, which has many applications in industry.Formula:C9H8BrNO4Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:274.07 g/mol2-(Bromomethyl)-3-nitrobenzoic Acid Methyl Ester
CAS:Controlled ProductApplications 2-(Bromomethyl)-3-nitrobenzoic Acid Methyl Ester (cas# 98475-07-1) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C9H8BrNO4Color and Shape:Off-White To Light YellowMolecular weight:274.07








